C10H10Cl2N4S — CID 65452782
N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanimidamide (PubChem CID 65452782) has the molecular formula C10H10Cl2N4S and a molecular weight of 289.19 g/mol. Its IUPAC name is N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanimidamide.
| Compound Name | N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanimidamide |
|---|---|
| PubChem CID | 65452782 |
| Molecular Formula | C10H10Cl2N4S |
| Molecular Weight | 289.19 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | N'-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-2-methylpropanimidamide |
| SMILES | CC(C)/C(N)=N/c1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C10H10Cl2N4S/c1-4(2)10(13)14-7-5(11)3-6(12)8-9(7)16-17-15-8/h3-4H,1-2H3,(H2,13,14) |
| InChIKey | XBWOCQPDPDLSOJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.19 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|