C16H30N2O — CID 65454165
2-amino-N-(2-ethylcyclohexyl)-5-methylcyclohexane-1-carboxamide (PubChem CID 65454165) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is 2-amino-N-(2-ethylcyclohexyl)-5-methylcyclohexane-1-carboxamide.
| Compound Name | 2-amino-N-(2-ethylcyclohexyl)-5-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 65454165 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | 2-amino-N-(2-ethylcyclohexyl)-5-methylcyclohexane-1-carboxamide |
| SMILES | CCC1CCCCC1NC(=O)C1CC(C)CCC1N |
| InChI | InChI=1S/C16H30N2O/c1-3-12-6-4-5-7-15(12)18-16(19)13-10-11(2)8-9-14(13)17/h11-15H,3-10,17H2,1-2H3,(H,18,19) |
| InChIKey | OCHYNPMNEYWIDB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |