About [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate (PubChem CID 654545) has the molecular formula C14H14F3NO4
and a molecular weight of 317.26 g/mol. Its IUPAC name is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate |
| PubChem CID | 654545 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate |
| SMILES | O=C(COC(=O)C1CCCO1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H14F3NO4/c15-14(16,17)9-3-1-4-10(7-9)18-12(19)8-22-13(20)11-5-2-6-21-11/h1,3-4,7,11H,2,5-6,8H2,(H,18,19) |
| InChIKey | AQFVAVKJJMDXDF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate?
The IUPAC name of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate (CID 654545) is [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate.
What is the SMILES notation for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate?
The canonical SMILES for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate is O=C(COC(=O)C1CCCO1)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate?
The InChIKey is AQFVAVKJJMDXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F3NO4/c15-14(16,17)9-3-1-4-10(7-9)18-12(19)8-22-13(20)11-5-2-6-21-11/h1,3-4,7,11H,2,5-6,8H2,(H,18,19).
What are the key properties of [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate?
[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate has a molecular weight of 317.26 g/mol, XLogP of 2.37, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-[3-(trifluoromethyl)anilino]ethyl] oxolane-2-carboxylate is sourced from PubChem (CID 654545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).