About 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline
2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline (PubChem CID 65454521) has the molecular formula C13H17N5O2S
and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline.
Molecular Properties
| Compound Name | 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline |
| PubChem CID | 65454521 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline |
| SMILES | Cc1ccc(N)c(-c2nnnn2CC2CCS(=O)(=O)C2)c1 |
| InChI | InChI=1S/C13H17N5O2S/c1-9-2-3-12(14)11(6-9)13-15-16-17-18(13)7-10-4-5-21(19,20)8-10/h2-3,6,10H,4-5,7-8,14H2,1H3 |
| InChIKey | ZAZLNZBWORYUCQ-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 103.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline?
The IUPAC name of 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline (CID 65454521) is 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline.
What is the SMILES notation for 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline?
The canonical SMILES for 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline is Cc1ccc(N)c(-c2nnnn2CC2CCS(=O)(=O)C2)c1.
What is the InChIKey of 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline?
The InChIKey is ZAZLNZBWORYUCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O2S/c1-9-2-3-12(14)11(6-9)13-15-16-17-18(13)7-10-4-5-21(19,20)8-10/h2-3,6,10H,4-5,7-8,14H2,1H3.
What are the key properties of 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline?
2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline has a molecular weight of 307.38 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[(1,1-dioxothiolan-3-yl)methyl]tetrazol-5-yl]-4-methylaniline is sourced from PubChem (CID 65454521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).