C14H22N2O3S — CID 65454692
N,5-dimethyl-N-(2-methylbutyl)-2-sulfamoylbenzamide (PubChem CID 65454692) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is N,5-dimethyl-N-(2-methylbutyl)-2-sulfamoylbenzamide.
| Compound Name | N,5-dimethyl-N-(2-methylbutyl)-2-sulfamoylbenzamide |
|---|---|
| PubChem CID | 65454692 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N,5-dimethyl-N-(2-methylbutyl)-2-sulfamoylbenzamide |
| SMILES | CCC(C)CN(C)C(=O)c1cc(C)ccc1S(N)(=O)=O |
| InChI | InChI=1S/C14H22N2O3S/c1-5-10(2)9-16(4)14(17)12-8-11(3)6-7-13(12)20(15,18)19/h6-8,10H,5,9H2,1-4H3,(H2,15,18,19) |
| InChIKey | SNVVLAMPNLCMSI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |