C19H23N — CID 65454761
N-ethyl-2-(4-phenylphenyl)cyclopentan-1-amine (PubChem CID 65454761) has the molecular formula C19H23N and a molecular weight of 265.40 g/mol. Its IUPAC name is N-ethyl-2-(4-phenylphenyl)cyclopentan-1-amine.
| Compound Name | N-ethyl-2-(4-phenylphenyl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 65454761 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | N-ethyl-2-(4-phenylphenyl)cyclopentan-1-amine |
| SMILES | CCNC1CCCC1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H23N/c1-2-20-19-10-6-9-18(19)17-13-11-16(12-14-17)15-7-4-3-5-8-15/h3-5,7-8,11-14,18-20H,2,6,9-10H2,1H3 |
| InChIKey | BAHJCASGNVHPNR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |