C18H21N3OS — CID 654548
2-(3-cyano-6-ethylquinolin-2-yl)sulfanyl-N,N-diethylacetamide (PubChem CID 654548) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(3-cyano-6-ethylquinolin-2-yl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(3-cyano-6-ethylquinolin-2-yl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 654548 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(3-cyano-6-ethylquinolin-2-yl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCc1ccc2nc(SCC(=O)N(CC)CC)c(C#N)cc2c1 |
| InChI | InChI=1S/C18H21N3OS/c1-4-13-7-8-16-14(9-13)10-15(11-19)18(20-16)23-12-17(22)21(5-2)6-3/h7-10H,4-6,12H2,1-3H3 |
| InChIKey | XUSQAHSCPIIXTC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |