C13H19NO2 — CID 65455743
5-(methoxymethoxy)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 65455743) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-(methoxymethoxy)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-(methoxymethoxy)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 65455743 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5-(methoxymethoxy)-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CNC1CCCc2c(OCOC)cccc21 |
| InChI | InChI=1S/C13H19NO2/c1-14-12-7-3-6-11-10(12)5-4-8-13(11)16-9-15-2/h4-5,8,12,14H,3,6-7,9H2,1-2H3 |
| InChIKey | UKWJINHKMCLIEE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|