About 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one
5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 65455954) has the molecular formula C12H12F2O2
and a molecular weight of 226.22 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one.
Molecular Properties
| Compound Name | 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| PubChem CID | 65455954 |
| Molecular Formula | C12H12F2O2 |
| Molecular Weight | 226.22 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCc2c(OCC(F)F)cccc21 |
| InChI | InChI=1S/C12H12F2O2/c13-12(14)7-16-11-6-2-3-8-9(11)4-1-5-10(8)15/h2-3,6,12H,1,4-5,7H2 |
| InChIKey | GEPGPBGJSOQTHW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The IUPAC name of 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one (CID 65455954) is 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one.
What is the SMILES notation for 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The canonical SMILES for 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one is O=C1CCCc2c(OCC(F)F)cccc21.
What is the InChIKey of 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one?
The InChIKey is GEPGPBGJSOQTHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2O2/c13-12(14)7-16-11-6-2-3-8-9(11)4-1-5-10(8)15/h2-3,6,12H,1,4-5,7H2.
What are the key properties of 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one?
5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one has a molecular weight of 226.22 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-difluoroethoxy)-3,4-dihydro-2H-naphthalen-1-one is sourced from PubChem (CID 65455954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).