C11H11NO3 — CID 65455986
2-(4-cyano-2,6-dimethylphenoxy)acetic acid (PubChem CID 65455986) has the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-(4-cyano-2,6-dimethylphenoxy)acetic acid.
| Compound Name | 2-(4-cyano-2,6-dimethylphenoxy)acetic acid |
|---|---|
| PubChem CID | 65455986 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-(4-cyano-2,6-dimethylphenoxy)acetic acid |
| SMILES | Cc1cc(C#N)cc(C)c1OCC(=O)O |
| InChI | InChI=1S/C11H11NO3/c1-7-3-9(5-12)4-8(2)11(7)15-6-10(13)14/h3-4H,6H2,1-2H3,(H,13,14) |
| InChIKey | CZXOUSRKQBAXMX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |