C12H14F2O2 — CID 65456544
5-(2,2-difluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 65456544) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 5-(2,2-difluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 65456544 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | OC1CCCc2c(OCC(F)F)cccc21 |
| InChI | InChI=1S/C12H14F2O2/c13-12(14)7-16-11-6-2-3-8-9(11)4-1-5-10(8)15/h2-3,6,10,12,15H,1,4-5,7H2 |
| InChIKey | XJFRMAJBJLEYND-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |