About 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile
4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile (PubChem CID 65456566) has the molecular formula C17H23NO
and a molecular weight of 257.38 g/mol. Its IUPAC name is 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile |
| PubChem CID | 65456566 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C#N)cc(C)c1OC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C17H23NO/c1-11-5-12(2)7-16(6-11)19-17-13(3)8-15(10-18)9-14(17)4/h8-9,11-12,16H,5-7H2,1-4H3 |
| InChIKey | DNORHDPDRSYMHD-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile?
The IUPAC name of 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile (CID 65456566) is 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile.
What is the SMILES notation for 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile?
The canonical SMILES for 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile is Cc1cc(C#N)cc(C)c1OC1CC(C)CC(C)C1.
What is the InChIKey of 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile?
The InChIKey is DNORHDPDRSYMHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO/c1-11-5-12(2)7-16(6-11)19-17-13(3)8-15(10-18)9-14(17)4/h8-9,11-12,16H,5-7H2,1-4H3.
What are the key properties of 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile?
4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile has a molecular weight of 257.38 g/mol, XLogP of 4.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylcyclohexyl)oxy-3,5-dimethylbenzonitrile is sourced from PubChem (CID 65456566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).