About 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine
2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine (PubChem CID 65459125) has the molecular formula C11H17N5
and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine.
Molecular Properties
| Compound Name | 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine |
| PubChem CID | 65459125 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine |
| SMILES | Cc1nn(C)cc1-c1cnc(C(C)(C)N)[nH]1 |
| InChI | InChI=1S/C11H17N5/c1-7-8(6-16(4)15-7)9-5-13-10(14-9)11(2,3)12/h5-6H,12H2,1-4H3,(H,13,14) |
| InChIKey | QWQLXHVLVGUCMS-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine?
The IUPAC name of 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine (CID 65459125) is 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine.
What is the SMILES notation for 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine?
The canonical SMILES for 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine is Cc1nn(C)cc1-c1cnc(C(C)(C)N)[nH]1.
What is the InChIKey of 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine?
The InChIKey is QWQLXHVLVGUCMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5/c1-7-8(6-16(4)15-7)9-5-13-10(14-9)11(2,3)12/h5-6H,12H2,1-4H3,(H,13,14).
What are the key properties of 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine?
2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine has a molecular weight of 219.29 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,3-dimethylpyrazol-4-yl)-1H-imidazol-2-yl]propan-2-amine is sourced from PubChem (CID 65459125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).