C12H17N — CID 65459852
N-(cyclobutylmethyl)-3-methylaniline (PubChem CID 65459852) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is N-(cyclobutylmethyl)-3-methylaniline.
| Compound Name | N-(cyclobutylmethyl)-3-methylaniline |
|---|---|
| PubChem CID | 65459852 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-(cyclobutylmethyl)-3-methylaniline |
| SMILES | Cc1cccc(NCC2CCC2)c1 |
| InChI | InChI=1S/C12H17N/c1-10-4-2-7-12(8-10)13-9-11-5-3-6-11/h2,4,7-8,11,13H,3,5-6,9H2,1H3 |
| InChIKey | UVOJALGVLXSJDD-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |