C10H18N2O2 — CID 6545987
(3R,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione (PubChem CID 6545987) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (3R,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione.
| Compound Name | (3R,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 6545987 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (3R,6S)-3,6-di(propan-2-yl)piperazine-2,5-dione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@@H](C(C)C)NC1=O |
| InChI | InChI=1S/C10H18N2O2/c1-5(2)7-9(13)12-8(6(3)4)10(14)11-7/h5-8H,1-4H3,(H,11,14)(H,12,13)/t7-,8+ |
| InChIKey | QGMAWEIDGADSAC-OCAPTIKFSA-N |
| XLogP | 0.28 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |