C14H19BrClN3O — CID 65460584
N-(4-bromo-2-chlorophenyl)-2-(2,2-dimethylpiperazin-1-yl)acetamide (PubChem CID 65460584) has the molecular formula C14H19BrClN3O and a molecular weight of 360.68 g/mol. Its IUPAC name is N-(4-bromo-2-chlorophenyl)-2-(2,2-dimethylpiperazin-1-yl)acetamide.
| Compound Name | N-(4-bromo-2-chlorophenyl)-2-(2,2-dimethylpiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 65460584 |
| Molecular Formula | C14H19BrClN3O |
| Molecular Weight | 360.68 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | N-(4-bromo-2-chlorophenyl)-2-(2,2-dimethylpiperazin-1-yl)acetamide |
| SMILES | CC1(C)CNCCN1CC(=O)Nc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H19BrClN3O/c1-14(2)9-17-5-6-19(14)8-13(20)18-12-4-3-10(15)7-11(12)16/h3-4,7,17H,5-6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | XAIYWPKMVANOCS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.68 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |