C13H16Cl2N2O — CID 65461126
(2,4-dichlorophenyl)-(2,2-dimethylpiperazin-1-yl)methanone (PubChem CID 65461126) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2,2-dimethylpiperazin-1-yl)methanone.
| Compound Name | (2,4-dichlorophenyl)-(2,2-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 65461126 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (2,4-dichlorophenyl)-(2,2-dimethylpiperazin-1-yl)methanone |
| SMILES | CC1(C)CNCCN1C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O/c1-13(2)8-16-5-6-17(13)12(18)10-4-3-9(14)7-11(10)15/h3-4,7,16H,5-6,8H2,1-2H3 |
| InChIKey | YIUAXJCYYVEVRF-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |