About N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide
N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide (PubChem CID 65461988) has the molecular formula C13H27N3O
and a molecular weight of 241.38 g/mol. Its IUPAC name is N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide.
Molecular Properties
| Compound Name | N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide |
| PubChem CID | 65461988 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N1CCNCC1(C)C |
| InChI | InChI=1S/C13H27N3O/c1-10(11(17)15-12(2,3)4)16-8-7-14-9-13(16,5)6/h10,14H,7-9H2,1-6H3,(H,15,17) |
| InChIKey | XSSJHYQECRQTCV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide?
The IUPAC name of N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide (CID 65461988) is N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide.
What is the SMILES notation for N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide?
The canonical SMILES for N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide is CC(C(=O)NC(C)(C)C)N1CCNCC1(C)C.
What is the InChIKey of N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide?
The InChIKey is XSSJHYQECRQTCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3O/c1-10(11(17)15-12(2,3)4)16-8-7-14-9-13(16,5)6/h10,14H,7-9H2,1-6H3,(H,15,17).
What are the key properties of N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide?
N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide has a molecular weight of 241.38 g/mol, XLogP of 0.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2-(2,2-dimethylpiperazin-1-yl)propanamide is sourced from PubChem (CID 65461988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).