About 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine
1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine (PubChem CID 65462562) has the molecular formula C7H14F2N2O2S
and a molecular weight of 228.26 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine |
| PubChem CID | 65462562 |
| Molecular Formula | C7H14F2N2O2S |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine |
| SMILES | CC1(C)CNCCN1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C7H14F2N2O2S/c1-7(2)5-10-3-4-11(7)14(12,13)6(8)9/h6,10H,3-5H2,1-2H3 |
| InChIKey | UKPDSKAKFHVSNX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine?
The IUPAC name of 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine (CID 65462562) is 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine.
What is the SMILES notation for 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine?
The canonical SMILES for 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine is CC1(C)CNCCN1S(=O)(=O)C(F)F.
What is the InChIKey of 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine?
The InChIKey is UKPDSKAKFHVSNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14F2N2O2S/c1-7(2)5-10-3-4-11(7)14(12,13)6(8)9/h6,10H,3-5H2,1-2H3.
What are the key properties of 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine?
1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine has a molecular weight of 228.26 g/mol, XLogP of 0.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethylsulfonyl)-2,2-dimethylpiperazine is sourced from PubChem (CID 65462562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).