About 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine
1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine (PubChem CID 65462682) has the molecular formula C19H30N2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine.
Molecular Properties
| Compound Name | 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine |
| PubChem CID | 65462682 |
| Molecular Formula | C19H30N2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine |
| SMILES | CCC1(CC)CNC(c2ccccc2)CN1CC1CCC1 |
| InChI | InChI=1S/C19H30N2/c1-3-19(4-2)15-20-18(17-11-6-5-7-12-17)14-21(19)13-16-9-8-10-16/h5-7,11-12,16,18,20H,3-4,8-10,13-15H2,1-2H3 |
| InChIKey | GDVRBBRDPLWTPE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine?
The IUPAC name of 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine (CID 65462682) is 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine.
What is the SMILES notation for 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine?
The canonical SMILES for 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine is CCC1(CC)CNC(c2ccccc2)CN1CC1CCC1.
What is the InChIKey of 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine?
The InChIKey is GDVRBBRDPLWTPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2/c1-3-19(4-2)15-20-18(17-11-6-5-7-12-17)14-21(19)13-16-9-8-10-16/h5-7,11-12,16,18,20H,3-4,8-10,13-15H2,1-2H3.
What are the key properties of 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine?
1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine has a molecular weight of 286.46 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclobutylmethyl)-2,2-diethyl-5-phenylpiperazine is sourced from PubChem (CID 65462682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).