About 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine
1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine (PubChem CID 65463380) has the molecular formula C12H21ClN4
and a molecular weight of 256.78 g/mol. Its IUPAC name is 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine |
| PubChem CID | 65463380 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine |
| SMILES | Cc1nn(C)c(Cl)c1CN1CCNCC1(C)C |
| InChI | InChI=1S/C12H21ClN4/c1-9-10(11(13)16(4)15-9)7-17-6-5-14-8-12(17,2)3/h14H,5-8H2,1-4H3 |
| InChIKey | NAGBVJORWFONBI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine?
The IUPAC name of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine (CID 65463380) is 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine.
What is the SMILES notation for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine?
The canonical SMILES for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine is Cc1nn(C)c(Cl)c1CN1CCNCC1(C)C.
What is the InChIKey of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine?
The InChIKey is NAGBVJORWFONBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN4/c1-9-10(11(13)16(4)15-9)7-17-6-5-14-8-12(17,2)3/h14H,5-8H2,1-4H3.
What are the key properties of 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine?
1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine has a molecular weight of 256.78 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-chloro-1,3-dimethylpyrazol-4-yl)methyl]-2,2-dimethylpiperazine is sourced from PubChem (CID 65463380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).