About 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine
1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine (PubChem CID 65464326) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine |
| PubChem CID | 65464326 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine |
| SMILES | NC1(c2nc3ccncc3[nH]2)CC1 |
| InChI | InChI=1S/C9H10N4/c10-9(2-3-9)8-12-6-1-4-11-5-7(6)13-8/h1,4-5H,2-3,10H2,(H,12,13) |
| InChIKey | OHNJQDSFGBFTJT-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine?
The IUPAC name of 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine (CID 65464326) is 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine.
What is the SMILES notation for 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine?
The canonical SMILES for 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine is NC1(c2nc3ccncc3[nH]2)CC1.
What is the InChIKey of 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine?
The InChIKey is OHNJQDSFGBFTJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c10-9(2-3-9)8-12-6-1-4-11-5-7(6)13-8/h1,4-5H,2-3,10H2,(H,12,13).
What are the key properties of 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine?
1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine has a molecular weight of 174.21 g/mol, XLogP of 0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3H-imidazo[4,5-c]pyridin-2-yl)cyclopropan-1-amine is sourced from PubChem (CID 65464326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).