C12H18N2OS — CID 65465761
1-amino-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclopropane-1-carboxamide (PubChem CID 65465761) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is 1-amino-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 65465761 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 1-amino-N-methyl-N-[1-(5-methylthiophen-2-yl)ethyl]cyclopropane-1-carboxamide |
| SMILES | Cc1ccc(C(C)N(C)C(=O)C2(N)CC2)s1 |
| InChI | InChI=1S/C12H18N2OS/c1-8-4-5-10(16-8)9(2)14(3)11(15)12(13)6-7-12/h4-5,9H,6-7,13H2,1-3H3 |
| InChIKey | UCGYJJQTYAJBLJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |