C14H13Cl2N — CID 65467797
2,6-dichloro-N-(1-phenylethyl)aniline (PubChem CID 65467797) has the molecular formula C14H13Cl2N and a molecular weight of 266.17 g/mol. Its IUPAC name is 2,6-dichloro-N-(1-phenylethyl)aniline.
| Compound Name | 2,6-dichloro-N-(1-phenylethyl)aniline |
|---|---|
| PubChem CID | 65467797 |
| Molecular Formula | C14H13Cl2N |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | 2,6-dichloro-N-(1-phenylethyl)aniline |
| SMILES | CC(Nc1c(Cl)cccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C14H13Cl2N/c1-10(11-6-3-2-4-7-11)17-14-12(15)8-5-9-13(14)16/h2-10,17H,1H3 |
| InChIKey | GBNCQPWNDIDITI-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |