C12H10BrF2NO — CID 65467932
4-bromo-2,6-difluoro-N-[1-(furan-2-yl)ethyl]aniline (PubChem CID 65467932) has the molecular formula C12H10BrF2NO and a molecular weight of 302.12 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-[1-(furan-2-yl)ethyl]aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-[1-(furan-2-yl)ethyl]aniline |
|---|---|
| PubChem CID | 65467932 |
| Molecular Formula | C12H10BrF2NO |
| Molecular Weight | 302.12 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-[1-(furan-2-yl)ethyl]aniline |
| SMILES | CC(Nc1c(F)cc(Br)cc1F)c1ccco1 |
| InChI | InChI=1S/C12H10BrF2NO/c1-7(11-3-2-4-17-11)16-12-9(14)5-8(13)6-10(12)15/h2-7,16H,1H3 |
| InChIKey | IGSKUDRNSQLVKC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |