About N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine
N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (PubChem CID 65468321) has the molecular formula C16H18BrF2N
and a molecular weight of 342.23 g/mol. Its IUPAC name is N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
Molecular Properties
| Compound Name | N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| PubChem CID | 65468321 |
| Molecular Formula | C16H18BrF2N |
| Molecular Weight | 342.23 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine |
| SMILES | Fc1cc(Br)cc(F)c1NC1CC2CC1C1CCCC21 |
| InChI | InChI=1S/C16H18BrF2N/c17-9-6-13(18)16(14(19)7-9)20-15-5-8-4-12(15)11-3-1-2-10(8)11/h6-8,10-12,15,20H,1-5H2 |
| InChIKey | XOONRYCXKQDSMY-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The IUPAC name of N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine (CID 65468321) is N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine.
What is the SMILES notation for N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The canonical SMILES for N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine is Fc1cc(Br)cc(F)c1NC1CC2CC1C1CCCC21.
What is the InChIKey of N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
The InChIKey is XOONRYCXKQDSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18BrF2N/c17-9-6-13(18)16(14(19)7-9)20-15-5-8-4-12(15)11-3-1-2-10(8)11/h6-8,10-12,15,20H,1-5H2.
What are the key properties of N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine?
N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine has a molecular weight of 342.23 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-bromo-2,6-difluorophenyl)tricyclo[5.2.1.02,6]decan-8-amine is sourced from PubChem (CID 65468321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).