C16H15ClFN3O2 — CID 6546833
(3S)-1-(3-chloro-4-fluorophenyl)-3-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidine-2,5-dione (PubChem CID 6546833) has the molecular formula C16H15ClFN3O2 and a molecular weight of 335.77 g/mol. Its IUPAC name is (3S)-1-(3-chloro-4-fluorophenyl)-3-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 6546833 |
| Molecular Formula | C16H15ClFN3O2 |
| Molecular Weight | 335.77 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | (3S)-1-(3-chloro-4-fluorophenyl)-3-[(3,5-dimethylpyrazol-1-yl)methyl]pyrrolidine-2,5-dione |
| SMILES | Cc1cc(C)n(C[C@@H]2CC(=O)N(c3ccc(F)c(Cl)c3)C2=O)n1 |
| InChI | InChI=1S/C16H15ClFN3O2/c1-9-5-10(2)20(19-9)8-11-6-15(22)21(16(11)23)12-3-4-14(18)13(17)7-12/h3-5,7,11H,6,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | RJOWOSLULMEQIJ-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|