About N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline
N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline (PubChem CID 65468370) has the molecular formula C18H23Cl2N
and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline.
Molecular Properties
| Compound Name | N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline |
| PubChem CID | 65468370 |
| Molecular Formula | C18H23Cl2N |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline |
| SMILES | CC(Nc1c(Cl)cccc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H23Cl2N/c1-11(21-17-15(19)3-2-4-16(17)20)18-8-12-5-13(9-18)7-14(6-12)10-18/h2-4,11-14,21H,5-10H2,1H3 |
| InChIKey | VZDCFPFQYDLQBX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline?
The IUPAC name of N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline (CID 65468370) is N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline.
What is the SMILES notation for N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline?
The canonical SMILES for N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline is CC(Nc1c(Cl)cccc1Cl)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline?
The InChIKey is VZDCFPFQYDLQBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23Cl2N/c1-11(21-17-15(19)3-2-4-16(17)20)18-8-12-5-13(9-18)7-14(6-12)10-18/h2-4,11-14,21H,5-10H2,1H3.
What are the key properties of N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline?
N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline has a molecular weight of 324.30 g/mol, XLogP of 6.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(1-adamantyl)ethyl]-2,6-dichloroaniline is sourced from PubChem (CID 65468370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).