C13H8Br2F2N2O2 — CID 65468429
4-bromo-N-[(2-bromo-4-nitrophenyl)methyl]-2,6-difluoroaniline (PubChem CID 65468429) has the molecular formula C13H8Br2F2N2O2 and a molecular weight of 422.02 g/mol. Its IUPAC name is 4-bromo-N-[(2-bromo-4-nitrophenyl)methyl]-2,6-difluoroaniline.
| Compound Name | 4-bromo-N-[(2-bromo-4-nitrophenyl)methyl]-2,6-difluoroaniline |
|---|---|
| PubChem CID | 65468429 |
| Molecular Formula | C13H8Br2F2N2O2 |
| Molecular Weight | 422.02 g/mol |
| Exact Mass | 419.89 |
| IUPAC Name | 4-bromo-N-[(2-bromo-4-nitrophenyl)methyl]-2,6-difluoroaniline |
| SMILES | O=[N+]([O-])c1ccc(CNc2c(F)cc(Br)cc2F)c(Br)c1 |
| InChI | InChI=1S/C13H8Br2F2N2O2/c14-8-3-11(16)13(12(17)4-8)18-6-7-1-2-9(19(20)21)5-10(7)15/h1-5,18H,6H2 |
| InChIKey | DQPOLHOXVTVPGZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.02 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|