C15H11Cl2NS — CID 65468569
N-(1-benzothiophen-3-ylmethyl)-2,6-dichloroaniline (PubChem CID 65468569) has the molecular formula C15H11Cl2NS and a molecular weight of 308.23 g/mol. Its IUPAC name is N-(1-benzothiophen-3-ylmethyl)-2,6-dichloroaniline.
| Compound Name | N-(1-benzothiophen-3-ylmethyl)-2,6-dichloroaniline |
|---|---|
| PubChem CID | 65468569 |
| Molecular Formula | C15H11Cl2NS |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | N-(1-benzothiophen-3-ylmethyl)-2,6-dichloroaniline |
| SMILES | Clc1cccc(Cl)c1NCc1csc2ccccc12 |
| InChI | InChI=1S/C15H11Cl2NS/c16-12-5-3-6-13(17)15(12)18-8-10-9-19-14-7-2-1-4-11(10)14/h1-7,9,18H,8H2 |
| InChIKey | LMPWHJSOZKWQJY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |