About N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline
N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline (PubChem CID 65468826) has the molecular formula C14H17Cl2N3
and a molecular weight of 298.22 g/mol. Its IUPAC name is N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline.
Molecular Properties
| Compound Name | N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline |
| PubChem CID | 65468826 |
| Molecular Formula | C14H17Cl2N3 |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline |
| SMILES | CCC(C)n1ccc(CNc2c(Cl)cccc2Cl)n1 |
| InChI | InChI=1S/C14H17Cl2N3/c1-3-10(2)19-8-7-11(18-19)9-17-14-12(15)5-4-6-13(14)16/h4-8,10,17H,3,9H2,1-2H3 |
| InChIKey | QTJGSQWUGRBNIN-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline?
The IUPAC name of N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline (CID 65468826) is N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline.
What is the SMILES notation for N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline?
The canonical SMILES for N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline is CCC(C)n1ccc(CNc2c(Cl)cccc2Cl)n1.
What is the InChIKey of N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline?
The InChIKey is QTJGSQWUGRBNIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17Cl2N3/c1-3-10(2)19-8-7-11(18-19)9-17-14-12(15)5-4-6-13(14)16/h4-8,10,17H,3,9H2,1-2H3.
What are the key properties of N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline?
N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline has a molecular weight of 298.22 g/mol, XLogP of 4.77, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1-butan-2-ylpyrazol-3-yl)methyl]-2,6-dichloroaniline is sourced from PubChem (CID 65468826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).