C12H8Cl2N4 — CID 65469093
5-amino-2-(2,6-dichloroanilino)pyridine-3-carbonitrile (PubChem CID 65469093) has the molecular formula C12H8Cl2N4 and a molecular weight of 279.13 g/mol. Its IUPAC name is 5-amino-2-(2,6-dichloroanilino)pyridine-3-carbonitrile.
| Compound Name | 5-amino-2-(2,6-dichloroanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 65469093 |
| Molecular Formula | C12H8Cl2N4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 5-amino-2-(2,6-dichloroanilino)pyridine-3-carbonitrile |
| SMILES | N#Cc1cc(N)cnc1Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H8Cl2N4/c13-9-2-1-3-10(14)11(9)18-12-7(5-15)4-8(16)6-17-12/h1-4,6H,16H2,(H,17,18) |
| InChIKey | SBGBQSNJIQYKBI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |