C11H12Cl2N4 — CID 65469847
5-N-(2,6-dichlorophenyl)-1,3-dimethylpyrazole-4,5-diamine (PubChem CID 65469847) has the molecular formula C11H12Cl2N4 and a molecular weight of 271.15 g/mol. Its IUPAC name is 5-N-(2,6-dichlorophenyl)-1,3-dimethylpyrazole-4,5-diamine.
| Compound Name | 5-N-(2,6-dichlorophenyl)-1,3-dimethylpyrazole-4,5-diamine |
|---|---|
| PubChem CID | 65469847 |
| Molecular Formula | C11H12Cl2N4 |
| Molecular Weight | 271.15 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 5-N-(2,6-dichlorophenyl)-1,3-dimethylpyrazole-4,5-diamine |
| SMILES | Cc1nn(C)c(Nc2c(Cl)cccc2Cl)c1N |
| InChI | InChI=1S/C11H12Cl2N4/c1-6-9(14)11(17(2)16-6)15-10-7(12)4-3-5-8(10)13/h3-5,15H,14H2,1-2H3 |
| InChIKey | HILDRISKCMUBFO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.15 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |