C15H23N3 — CID 65471399
3-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzene-1,3-diamine (PubChem CID 65471399) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 3-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzene-1,3-diamine.
| Compound Name | 3-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 65471399 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 3-N-(9-methyl-9-azabicyclo[3.3.1]nonan-3-yl)benzene-1,3-diamine |
| SMILES | CN1C2CCCC1CC(Nc1cccc(N)c1)C2 |
| InChI | InChI=1S/C15H23N3/c1-18-14-6-3-7-15(18)10-13(9-14)17-12-5-2-4-11(16)8-12/h2,4-5,8,13-15,17H,3,6-7,9-10,16H2,1H3 |
| InChIKey | RNYNPJMFNSJBSN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|