About 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide
4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide (PubChem CID 65471566) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide.
Molecular Properties
| Compound Name | 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide |
| PubChem CID | 65471566 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C(N)=O)cc(C)c1OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C15H21NO3/c1-9-6-11(14(16)18)7-10(2)13(9)19-8-12(17)15(3,4)5/h6-7H,8H2,1-5H3,(H2,16,18) |
| InChIKey | HKVSHJHOSRCNQL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide?
The IUPAC name of 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide (CID 65471566) is 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide.
What is the SMILES notation for 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide?
The canonical SMILES for 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide is Cc1cc(C(N)=O)cc(C)c1OCC(=O)C(C)(C)C.
What is the InChIKey of 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide?
The InChIKey is HKVSHJHOSRCNQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO3/c1-9-6-11(14(16)18)7-10(2)13(9)19-8-12(17)15(3,4)5/h6-7H,8H2,1-5H3,(H2,16,18).
What are the key properties of 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide?
4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide has a molecular weight of 263.34 g/mol, XLogP of 2.40, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethyl-2-oxobutoxy)-3,5-dimethylbenzamide is sourced from PubChem (CID 65471566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).