About 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine
1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine (PubChem CID 654719) has the molecular formula C23H30N6O2
and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine.
Molecular Properties
| Compound Name | 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine |
| PubChem CID | 654719 |
| Molecular Formula | C23H30N6O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine |
| SMILES | COc1ccc(C(c2nnnn2CCc2ccccc2)N2CCN(C)CC2)cc1OC |
| InChI | InChI=1S/C23H30N6O2/c1-27-13-15-28(16-14-27)22(19-9-10-20(30-2)21(17-19)31-3)23-24-25-26-29(23)12-11-18-7-5-4-6-8-18/h4-10,17,22H,11-16H2,1-3H3 |
| InChIKey | VFMUGBFABSUSKZ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 68.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine (CID 654719) is 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine is COc1ccc(C(c2nnnn2CCc2ccccc2)N2CCN(C)CC2)cc1OC.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine?
The InChIKey is VFMUGBFABSUSKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N6O2/c1-27-13-15-28(16-14-27)22(19-9-10-20(30-2)21(17-19)31-3)23-24-25-26-29(23)12-11-18-7-5-4-6-8-18/h4-10,17,22H,11-16H2,1-3H3.
What are the key properties of 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine?
1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine has a molecular weight of 422.53 g/mol, XLogP of 2.27, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)-[1-(2-phenylethyl)tetrazol-5-yl]methyl]-4-methylpiperazine is sourced from PubChem (CID 654719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).