C16H15ClFNOS — CID 65472294
4-[(2-chloro-6-fluorophenyl)methoxy]-3,5-dimethylbenzenecarbothioamide (PubChem CID 65472294) has the molecular formula C16H15ClFNOS and a molecular weight of 323.82 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methoxy]-3,5-dimethylbenzenecarbothioamide.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methoxy]-3,5-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 65472294 |
| Molecular Formula | C16H15ClFNOS |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methoxy]-3,5-dimethylbenzenecarbothioamide |
| SMILES | Cc1cc(C(N)=S)cc(C)c1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C16H15ClFNOS/c1-9-6-11(16(19)21)7-10(2)15(9)20-8-12-13(17)4-3-5-14(12)18/h3-7H,8H2,1-2H3,(H2,19,21) |
| InChIKey | PYSIEKXTDAAKEF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|