C10H7Cl2N3S — CID 65473505
N-but-2-ynyl-5,7-dichloro-2,1,3-benzothiadiazol-4-amine (PubChem CID 65473505) has the molecular formula C10H7Cl2N3S and a molecular weight of 272.16 g/mol. Its IUPAC name is N-but-2-ynyl-5,7-dichloro-2,1,3-benzothiadiazol-4-amine.
| Compound Name | N-but-2-ynyl-5,7-dichloro-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65473505 |
| Molecular Formula | C10H7Cl2N3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | N-but-2-ynyl-5,7-dichloro-2,1,3-benzothiadiazol-4-amine |
| SMILES | CC#CCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C10H7Cl2N3S/c1-2-3-4-13-8-6(11)5-7(12)9-10(8)15-16-14-9/h5,13H,4H2,1H3 |
| InChIKey | DAEQWBKRGVIQKG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|