About 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide
5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide (PubChem CID 65473609) has the molecular formula C12H6BrClN4OS
and a molecular weight of 369.63 g/mol. Its IUPAC name is 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide |
| PubChem CID | 65473609 |
| Molecular Formula | C12H6BrClN4OS |
| Molecular Weight | 369.63 g/mol |
| Exact Mass | 367.91 |
| IUPAC Name | 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1c(Cl)ccc2nsnc12)c1cncc(Br)c1 |
| InChI | InChI=1S/C12H6BrClN4OS/c13-7-3-6(4-15-5-7)12(19)16-10-8(14)1-2-9-11(10)18-20-17-9/h1-5H,(H,16,19) |
| InChIKey | NCICQIVKCLCARD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide?
The IUPAC name of 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide (CID 65473609) is 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide.
What is the SMILES notation for 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide?
The canonical SMILES for 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide is O=C(Nc1c(Cl)ccc2nsnc12)c1cncc(Br)c1.
What is the InChIKey of 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide?
The InChIKey is NCICQIVKCLCARD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6BrClN4OS/c13-7-3-6(4-15-5-7)12(19)16-10-8(14)1-2-9-11(10)18-20-17-9/h1-5H,(H,16,19).
What are the key properties of 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide?
5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide has a molecular weight of 369.63 g/mol, XLogP of 3.75, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)pyridine-3-carboxamide is sourced from PubChem (CID 65473609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).