C11H11ClF3N3OS — CID 65474095
5-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 65474095) has the molecular formula C11H11ClF3N3OS and a molecular weight of 325.74 g/mol. Its IUPAC name is 5-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65474095 |
| Molecular Formula | C11H11ClF3N3OS |
| Molecular Weight | 325.74 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | 5-chloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | FC(F)(F)COCCCNc1c(Cl)ccc2nsnc12 |
| InChI | InChI=1S/C11H11ClF3N3OS/c12-7-2-3-8-10(18-20-17-8)9(7)16-4-1-5-19-6-11(13,14)15/h2-3,16H,1,4-6H2 |
| InChIKey | RGBGCKAVNPNUCV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.74 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|