C25H17N3O3 — CID 6547432
phenyl (1S,2R,3aR)-3,3-dicyano-2-(furan-3-yl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-1-carboxylate (PubChem CID 6547432) has the molecular formula C25H17N3O3 and a molecular weight of 407.43 g/mol. Its IUPAC name is phenyl (1S,2R,3aR)-3,3-dicyano-2-(furan-3-yl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-1-carboxylate.
| Compound Name | phenyl (1S,2R,3aR)-3,3-dicyano-2-(furan-3-yl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 6547432 |
| Molecular Formula | C25H17N3O3 |
| Molecular Weight | 407.43 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | phenyl (1S,2R,3aR)-3,3-dicyano-2-(furan-3-yl)-2,3a-dihydro-1H-pyrrolo[1,2-a]quinoline-1-carboxylate |
| SMILES | N#CC1(C#N)[C@H](c2ccoc2)[C@@H](C(=O)Oc2ccccc2)N2c3ccccc3C=C[C@@H]21 |
| InChI | InChI=1S/C25H17N3O3/c26-15-25(16-27)21-11-10-17-6-4-5-9-20(17)28(21)23(22(25)18-12-13-30-14-18)24(29)31-19-7-2-1-3-8-19/h1-14,21-23H/t21-,22-,23+/m1/s1 |
| InChIKey | FWYQTWKAYMEBJL-ZLNRFVROSA-N |
| XLogP | 4.29 |
| TPSA | 90.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|