C13H17Cl2N3OS — CID 65474670
5,7-dichloro-N-[2-(3-methylbutoxy)ethyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 65474670) has the molecular formula C13H17Cl2N3OS and a molecular weight of 334.27 g/mol. Its IUPAC name is 5,7-dichloro-N-[2-(3-methylbutoxy)ethyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-[2-(3-methylbutoxy)ethyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65474670 |
| Molecular Formula | C13H17Cl2N3OS |
| Molecular Weight | 334.27 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | 5,7-dichloro-N-[2-(3-methylbutoxy)ethyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | CC(C)CCOCCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C13H17Cl2N3OS/c1-8(2)3-5-19-6-4-16-11-9(14)7-10(15)12-13(11)18-20-17-12/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | UQBUSNCOJQEBOK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|