C11H10Cl2F3N3OS — CID 65475055
5,7-dichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine (PubChem CID 65475055) has the molecular formula C11H10Cl2F3N3OS and a molecular weight of 360.19 g/mol. Its IUPAC name is 5,7-dichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5,7-dichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 65475055 |
| Molecular Formula | C11H10Cl2F3N3OS |
| Molecular Weight | 360.19 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | 5,7-dichloro-N-[3-(2,2,2-trifluoroethoxy)propyl]-2,1,3-benzothiadiazol-4-amine |
| SMILES | FC(F)(F)COCCCNc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C11H10Cl2F3N3OS/c12-6-4-7(13)9-10(19-21-18-9)8(6)17-2-1-3-20-5-11(14,15)16/h4,17H,1-3,5H2 |
| InChIKey | WXKKZCWYANCMPS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.19 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|