C25H22Cl2N2O2S — CID 6547513
(3aR,4S,9bS)-N-(2,5-dichlorophenyl)-4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide (PubChem CID 6547513) has the molecular formula C25H22Cl2N2O2S and a molecular weight of 485.44 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-(2,5-dichlorophenyl)-4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide.
| Compound Name | (3aR,4S,9bS)-N-(2,5-dichlorophenyl)-4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
|---|---|
| PubChem CID | 6547513 |
| Molecular Formula | C25H22Cl2N2O2S |
| Molecular Weight | 485.44 g/mol |
| Exact Mass | 484.08 |
| IUPAC Name | (3aR,4S,9bS)-N-(2,5-dichlorophenyl)-4-(3-methylphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-sulfonamide |
| SMILES | Cc1cccc([C@H]2Nc3ccc(S(=O)(=O)Nc4cc(Cl)ccc4Cl)cc3[C@H]3C=CC[C@H]32)c1 |
| InChI | InChI=1S/C25H22Cl2N2O2S/c1-15-4-2-5-16(12-15)25-20-7-3-6-19(20)21-14-18(9-11-23(21)28-25)32(30,31)29-24-13-17(26)8-10-22(24)27/h2-6,8-14,19-20,25,28-29H,7H2,1H3/t19-,20+,25+/m0/s1 |
| InChIKey | NBHKLQPTGBSLCF-WZOHSFFVSA-N |
| XLogP | 6.93 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.44 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|