C12H7ClF2N4S — CID 65475234
1-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,6-difluorobenzene-1,4-diamine (PubChem CID 65475234) has the molecular formula C12H7ClF2N4S and a molecular weight of 312.73 g/mol. Its IUPAC name is 1-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,6-difluorobenzene-1,4-diamine.
| Compound Name | 1-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,6-difluorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 65475234 |
| Molecular Formula | C12H7ClF2N4S |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1-N-(5-chloro-2,1,3-benzothiadiazol-4-yl)-2,6-difluorobenzene-1,4-diamine |
| SMILES | Nc1cc(F)c(Nc2c(Cl)ccc3nsnc23)c(F)c1 |
| InChI | InChI=1S/C12H7ClF2N4S/c13-6-1-2-9-12(19-20-18-9)10(6)17-11-7(14)3-5(16)4-8(11)15/h1-4,17H,16H2 |
| InChIKey | HOBGSKRCQIGPPY-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|