C11H10Cl2N4OS2 — CID 65475339
2-carbamothioyl-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)butanamide (PubChem CID 65475339) has the molecular formula C11H10Cl2N4OS2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 2-carbamothioyl-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)butanamide.
| Compound Name | 2-carbamothioyl-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)butanamide |
|---|---|
| PubChem CID | 65475339 |
| Molecular Formula | C11H10Cl2N4OS2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 2-carbamothioyl-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)butanamide |
| SMILES | CCC(C(=O)Nc1c(Cl)cc(Cl)c2nsnc12)C(N)=S |
| InChI | InChI=1S/C11H10Cl2N4OS2/c1-2-4(10(14)19)11(18)15-7-5(12)3-6(13)8-9(7)17-20-16-8/h3-4H,2H2,1H3,(H2,14,19)(H,15,18) |
| InChIKey | BSUQKAAJLZJOCS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|