About 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine
5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine (PubChem CID 65475599) has the molecular formula C11H12ClN3S
and a molecular weight of 253.76 g/mol. Its IUPAC name is 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine.
Molecular Properties
| Compound Name | 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine |
| PubChem CID | 65475599 |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.76 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine |
| SMILES | Clc1ccc2nsnc2c1NC1CCCC1 |
| InChI | InChI=1S/C11H12ClN3S/c12-8-5-6-9-11(15-16-14-9)10(8)13-7-3-1-2-4-7/h5-7,13H,1-4H2 |
| InChIKey | MZJMJDDXNJGTLC-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.76 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine?
The IUPAC name of 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine (CID 65475599) is 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine.
What is the SMILES notation for 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine?
The canonical SMILES for 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine is Clc1ccc2nsnc2c1NC1CCCC1.
What is the InChIKey of 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine?
The InChIKey is MZJMJDDXNJGTLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3S/c12-8-5-6-9-11(15-16-14-9)10(8)13-7-3-1-2-4-7/h5-7,13H,1-4H2.
What are the key properties of 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine?
5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine has a molecular weight of 253.76 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-cyclopentyl-2,1,3-benzothiadiazol-4-amine is sourced from PubChem (CID 65475599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).