C12H8Cl2N4S — CID 65475612
2-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)benzene-1,2-diamine (PubChem CID 65475612) has the molecular formula C12H8Cl2N4S and a molecular weight of 311.20 g/mol. Its IUPAC name is 2-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)benzene-1,2-diamine.
| Compound Name | 2-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 65475612 |
| Molecular Formula | C12H8Cl2N4S |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 2-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)benzene-1,2-diamine |
| SMILES | Nc1ccccc1Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C12H8Cl2N4S/c13-6-5-7(14)11-12(18-19-17-11)10(6)16-9-4-2-1-3-8(9)15/h1-5,16H,15H2 |
| InChIKey | WGQWDUDGLGARSP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|