C14H19IO2 — CID 65478285
4-[(4-iodophenyl)methyl]-2,2-dimethyloxan-4-ol (PubChem CID 65478285) has the molecular formula C14H19IO2 and a molecular weight of 346.21 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methyl]-2,2-dimethyloxan-4-ol.
| Compound Name | 4-[(4-iodophenyl)methyl]-2,2-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 65478285 |
| Molecular Formula | C14H19IO2 |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.04 |
| IUPAC Name | 4-[(4-iodophenyl)methyl]-2,2-dimethyloxan-4-ol |
| SMILES | CC1(C)CC(O)(Cc2ccc(I)cc2)CCO1 |
| InChI | InChI=1S/C14H19IO2/c1-13(2)10-14(16,7-8-17-13)9-11-3-5-12(15)6-4-11/h3-6,16H,7-10H2,1-2H3 |
| InChIKey | LGVCUTDDOMSESD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|