C17H18INO2 — CID 65478869
4-[N-[(4-iodophenyl)methyl]anilino]butanoic acid (PubChem CID 65478869) has the molecular formula C17H18INO2 and a molecular weight of 395.24 g/mol. Its IUPAC name is 4-[N-[(4-iodophenyl)methyl]anilino]butanoic acid.
| Compound Name | 4-[N-[(4-iodophenyl)methyl]anilino]butanoic acid |
|---|---|
| PubChem CID | 65478869 |
| Molecular Formula | C17H18INO2 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 4-[N-[(4-iodophenyl)methyl]anilino]butanoic acid |
| SMILES | O=C(O)CCCN(Cc1ccc(I)cc1)c1ccccc1 |
| InChI | InChI=1S/C17H18INO2/c18-15-10-8-14(9-11-15)13-19(12-4-7-17(20)21)16-5-2-1-3-6-16/h1-3,5-6,8-11H,4,7,12-13H2,(H,20,21) |
| InChIKey | FSQVTUWSBOLEKX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|